C20H38N10O7 — CID 18303127
4-amino-2-[[2-[[4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoic acid (PubChem CID 18303127) has the molecular formula C20H38N10O7 and a molecular weight of 530.59 g/mol. Its IUPAC name is 4-amino-2-[[2-[[4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[2-[[4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18303127 |
| Molecular Formula | C20H38N10O7 |
| Molecular Weight | 530.59 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | 4-amino-2-[[2-[[4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(CC(N)=O)C(=O)NC(CCCN=C(N)N)C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C20H38N10O7/c21-6-2-1-4-10(22)16(33)29-12(8-14(23)31)18(35)28-11(5-3-7-27-20(25)26)17(34)30-13(19(36)37)9-15(24)32/h10-13H,1-9,21-22H2,(H2,23,31)(H2,24,32)(H,28,35)(H,29,33)(H,30,34)(H,36,37)(H4,25,26,27) |
| InChIKey | SPEUHRWSRFUZPC-UHFFFAOYSA-N |
| XLogP | -5.21 |
| TPSA | 327.22 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.59 |
| LogP ≤ 5 | -5.21 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|