C21H40N10O7 — CID 22701020
6-amino-2-[[4-amino-2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-4-oxobutanoyl]amino]hexanoic acid (PubChem CID 22701020) has the molecular formula C21H40N10O7 and a molecular weight of 544.61 g/mol. Its IUPAC name is 6-amino-2-[[4-amino-2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-4-oxobutanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[4-amino-2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-4-oxobutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 22701020 |
| Molecular Formula | C21H40N10O7 |
| Molecular Weight | 544.61 g/mol |
| Exact Mass | 544.31 |
| IUPAC Name | 6-amino-2-[[4-amino-2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-4-oxobutanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(CC(N)=O)NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C21H40N10O7/c22-8-2-1-4-13(20(37)38)30-19(36)14(10-16(25)33)31-18(35)12(5-3-9-28-21(26)27)29-17(34)11(23)6-7-15(24)32/h11-14H,1-10,22-23H2,(H2,24,32)(H2,25,33)(H,29,34)(H,30,36)(H,31,35)(H,37,38)(H4,26,27,28) |
| InChIKey | HKMJMJNGUMJSCU-UHFFFAOYSA-N |
| XLogP | -4.82 |
| TPSA | 327.22 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.61 |
| LogP ≤ 5 | -4.82 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|