C17H30N8O8S — CID 18255705
4-amino-2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-carboxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoic acid (PubChem CID 18255705) has the molecular formula C17H30N8O8S and a molecular weight of 506.54 g/mol. Its IUPAC name is 4-amino-2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-carboxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-carboxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18255705 |
| Molecular Formula | C17H30N8O8S |
| Molecular Weight | 506.54 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | 4-amino-2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-carboxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoic acid |
| SMILES | NC(=O)CC(NC(=O)C(CCCN=C(N)N)NC(=O)C(CC(=O)O)NC(=O)C(N)CS)C(=O)O |
| InChI | InChI=1S/C17H30N8O8S/c18-7(6-34)13(29)24-9(5-12(27)28)15(31)23-8(2-1-3-22-17(20)21)14(30)25-10(16(32)33)4-11(19)26/h7-10,34H,1-6,18H2,(H2,19,26)(H,23,31)(H,24,29)(H,25,30)(H,27,28)(H,32,33)(H4,20,21,22) |
| InChIKey | BITQIZKHWCVTDE-UHFFFAOYSA-N |
| XLogP | -4.81 |
| TPSA | 295.41 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.54 |
| LogP ≤ 5 | -4.81 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|