C13H24N6O6S — CID 18219766
2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]butanedioic acid (PubChem CID 18219766) has the molecular formula C13H24N6O6S and a molecular weight of 392.44 g/mol. Its IUPAC name is 2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18219766 |
| Molecular Formula | C13H24N6O6S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]butanedioic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C(N)CS)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C13H24N6O6S/c14-6(5-26)10(22)18-7(2-1-3-17-13(15)16)11(23)19-8(12(24)25)4-9(20)21/h6-8,26H,1-5,14H2,(H,18,22)(H,19,23)(H,20,21)(H,24,25)(H4,15,16,17) |
| InChIKey | GMXSSZUVDNPRMA-UHFFFAOYSA-N |
| XLogP | -3.17 |
| TPSA | 223.22 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | -3.17 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|