C18H32N8O8S — CID 18242970
3-[[5-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]-4-[(1-carboxy-2-sulfanylethyl)amino]-4-oxobutanoic acid (PubChem CID 18242970) has the molecular formula C18H32N8O8S and a molecular weight of 520.57 g/mol. Its IUPAC name is 3-[[5-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]-4-[(1-carboxy-2-sulfanylethyl)amino]-4-oxobutanoic acid.
| Compound Name | 3-[[5-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]-4-[(1-carboxy-2-sulfanylethyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18242970 |
| Molecular Formula | C18H32N8O8S |
| Molecular Weight | 520.57 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | 3-[[5-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]-4-[(1-carboxy-2-sulfanylethyl)amino]-4-oxobutanoic acid |
| SMILES | NC(=O)CCC(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CC(=O)O)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C18H32N8O8S/c19-8(2-1-5-23-18(21)22)14(30)24-9(3-4-12(20)27)15(31)25-10(6-13(28)29)16(32)26-11(7-35)17(33)34/h8-11,35H,1-7,19H2,(H2,20,27)(H,24,30)(H,25,31)(H,26,32)(H,28,29)(H,33,34)(H4,21,22,23) |
| InChIKey | KKRTXKFBZDXBRX-UHFFFAOYSA-N |
| XLogP | -4.42 |
| TPSA | 295.41 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.57 |
| LogP ≤ 5 | -4.42 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|