C17H32N8O6S2 — CID 18242232
2-[[5-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]-5-oxopentanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 18242232) has the molecular formula C17H32N8O6S2 and a molecular weight of 508.63 g/mol. Its IUPAC name is 2-[[5-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]-5-oxopentanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[5-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]-5-oxopentanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18242232 |
| Molecular Formula | C17H32N8O6S2 |
| Molecular Weight | 508.63 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | 2-[[5-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]-5-oxopentanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | NC(=O)CCC(NC(=O)C(CS)NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C17H32N8O6S2/c18-8(2-1-5-22-17(20)21)13(27)24-10(6-32)15(29)23-9(3-4-12(19)26)14(28)25-11(7-33)16(30)31/h8-11,32-33H,1-7,18H2,(H2,19,26)(H,23,29)(H,24,27)(H,25,28)(H,30,31)(H4,20,21,22) |
| InChIKey | DMPOXABQGJWQBC-UHFFFAOYSA-N |
| XLogP | -3.97 |
| TPSA | 258.11 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.63 |
| LogP ≤ 5 | -3.97 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|