C15H31N9O4S — CID 145453736
(2R)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 145453736) has the molecular formula C15H31N9O4S and a molecular weight of 433.54 g/mol. Its IUPAC name is (2R)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 145453736 |
| Molecular Formula | C15H31N9O4S |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | (2R)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)[C@@H](N)CCCN=C(N)N)C(=O)N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C15H31N9O4S/c16-8(3-1-5-21-14(17)18)11(25)23-9(4-2-6-22-15(19)20)12(26)24-10(7-29)13(27)28/h8-10,29H,1-7,16H2,(H,23,25)(H,24,26)(H,27,28)(H4,17,18,21)(H4,19,20,22)/t8-,9-,10-/m0/s1 |
| InChIKey | KJGNDQCYBNBXDA-GUBZILKMSA-N |
| XLogP | -3.60 |
| TPSA | 250.32 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | -3.60 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|