C21H43N11O5S — CID 10099377
(2S)-2-[[(2S)-2-[[(2S)-6-amino-2-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 10099377) has the molecular formula C21H43N11O5S and a molecular weight of 561.71 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-6-amino-2-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-6-amino-2-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 10099377 |
| Molecular Formula | C21H43N11O5S |
| Molecular Weight | 561.71 g/mol |
| Exact Mass | 561.32 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-6-amino-2-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NCCCC[C@H](NC(=O)[C@H](N)CCCN=C(N)N)C(=O)N[C@H](CS)C(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C21H43N11O5S/c22-8-2-1-6-13(30-16(33)12(23)5-3-9-28-20(24)25)17(34)32-15(11-38)18(35)31-14(19(36)37)7-4-10-29-21(26)27/h12-15,38H,1-11,22-23H2,(H,30,33)(H,31,35)(H,32,34)(H,36,37)(H4,24,25,28)(H4,26,27,29)/t12-,13+,14+,15-/m1/s1 |
| InChIKey | LGQBCIVXMWCRAP-CBBWQLFWSA-N |
| XLogP | -3.98 |
| TPSA | 305.44 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.71 |
| LogP ≤ 5 | -3.98 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|