C20H38N8O7S — CID 18304322
5-[[1-[(1-carboxy-2-sulfanylethyl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-(2,6-diaminohexanoylamino)-5-oxopentanoic acid (PubChem CID 18304322) has the molecular formula C20H38N8O7S and a molecular weight of 534.64 g/mol. Its IUPAC name is 5-[[1-[(1-carboxy-2-sulfanylethyl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-(2,6-diaminohexanoylamino)-5-oxopentanoic acid.
| Compound Name | 5-[[1-[(1-carboxy-2-sulfanylethyl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-(2,6-diaminohexanoylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18304322 |
| Molecular Formula | C20H38N8O7S |
| Molecular Weight | 534.64 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | 5-[[1-[(1-carboxy-2-sulfanylethyl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-(2,6-diaminohexanoylamino)-5-oxopentanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(CCC(=O)O)C(=O)NC(CCCN=C(N)N)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C20H38N8O7S/c21-8-2-1-4-11(22)16(31)26-13(6-7-15(29)30)18(33)27-12(5-3-9-25-20(23)24)17(32)28-14(10-36)19(34)35/h11-14,36H,1-10,21-22H2,(H,26,31)(H,27,33)(H,28,32)(H,29,30)(H,34,35)(H4,23,24,25) |
| InChIKey | BUGRRSGAYIMVHG-UHFFFAOYSA-N |
| XLogP | -3.17 |
| TPSA | 278.34 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.64 |
| LogP ≤ 5 | -3.17 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|