C20H38N8O8 — CID 18302827
5-[(1-carboxy-2-hydroxyethyl)amino]-4-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid (PubChem CID 18302827) has the molecular formula C20H38N8O8 and a molecular weight of 518.57 g/mol. Its IUPAC name is 5-[(1-carboxy-2-hydroxyethyl)amino]-4-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-[(1-carboxy-2-hydroxyethyl)amino]-4-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18302827 |
| Molecular Formula | C20H38N8O8 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.28 |
| IUPAC Name | 5-[(1-carboxy-2-hydroxyethyl)amino]-4-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCC(=O)O)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C20H38N8O8/c21-8-2-1-4-11(22)16(32)26-12(5-3-9-25-20(23)24)17(33)27-13(6-7-15(30)31)18(34)28-14(10-29)19(35)36/h11-14,29H,1-10,21-22H2,(H,26,32)(H,27,33)(H,28,34)(H,30,31)(H,35,36)(H4,23,24,25) |
| InChIKey | LDXRMQDYECDCQN-UHFFFAOYSA-N |
| XLogP | -4.11 |
| TPSA | 298.57 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | -4.11 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|