C19H36N8O8 — CID 18308269
2-[[2-[[2-(2,6-diaminohexanoylamino)-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]butanedioic acid (PubChem CID 18308269) has the molecular formula C19H36N8O8 and a molecular weight of 504.55 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18308269 |
| Molecular Formula | C19H36N8O8 |
| Molecular Weight | 504.55 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]butanedioic acid |
| SMILES | NCCCCC(N)C(=O)NC(CO)C(=O)NC(CCCN=C(N)N)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C19H36N8O8/c20-6-2-1-4-10(21)15(31)27-13(9-28)17(33)25-11(5-3-7-24-19(22)23)16(32)26-12(18(34)35)8-14(29)30/h10-13,28H,1-9,20-21H2,(H,25,33)(H,26,32)(H,27,31)(H,29,30)(H,34,35)(H4,22,23,24) |
| InChIKey | JXXTWRGWGQSOKH-UHFFFAOYSA-N |
| XLogP | -4.50 |
| TPSA | 298.57 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.55 |
| LogP ≤ 5 | -4.50 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|