C16H29N7O9 — CID 22650393
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxypropanoyl]amino]butanedioic acid (PubChem CID 22650393) has the molecular formula C16H29N7O9 and a molecular weight of 463.45 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxypropanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxypropanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 22650393 |
| Molecular Formula | C16H29N7O9 |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxypropanoyl]amino]butanedioic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)NC(CO)C(=O)NC(CO)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H29N7O9/c17-7(2-1-3-20-16(18)19)12(28)22-9(5-24)14(30)23-10(6-25)13(29)21-8(15(31)32)4-11(26)27/h7-10,24-25H,1-6,17H2,(H,21,29)(H,22,28)(H,23,30)(H,26,27)(H,31,32)(H4,18,19,20) |
| InChIKey | RHDUJLNAXBQLAM-UHFFFAOYSA-N |
| XLogP | -5.63 |
| TPSA | 292.78 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | -5.63 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|