C19H37N11O7 — CID 18241610
2-[[2-[[4-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoyl]amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18241610) has the molecular formula C19H37N11O7 and a molecular weight of 531.58 g/mol. Its IUPAC name is 2-[[2-[[4-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoyl]amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[4-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoyl]amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18241610 |
| Molecular Formula | C19H37N11O7 |
| Molecular Weight | 531.58 g/mol |
| Exact Mass | 531.29 |
| IUPAC Name | 2-[[2-[[4-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoyl]amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(=O)CC(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CO)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C19H37N11O7/c20-9(3-1-5-26-18(22)23)14(33)29-11(7-13(21)32)15(34)30-12(8-31)16(35)28-10(17(36)37)4-2-6-27-19(24)25/h9-12,31H,1-8,20H2,(H2,21,32)(H,28,35)(H,29,33)(H,30,34)(H,36,37)(H4,22,23,26)(H4,24,25,27) |
| InChIKey | WXGAHDVUEFNHHZ-UHFFFAOYSA-N |
| XLogP | -6.17 |
| TPSA | 342.74 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.58 |
| LogP ≤ 5 | -6.17 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|