C17H29N7O10 — CID 18248002
2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-carboxypropanoyl]amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18248002) has the molecular formula C17H29N7O10 and a molecular weight of 491.46 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-carboxypropanoyl]amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-carboxypropanoyl]amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18248002 |
| Molecular Formula | C17H29N7O10 |
| Molecular Weight | 491.46 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-carboxypropanoyl]amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C(CO)NC(=O)C(CC(=O)O)NC(=O)C(N)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H29N7O10/c18-7(4-11(26)27)13(30)23-9(5-12(28)29)14(31)24-10(6-25)15(32)22-8(16(33)34)2-1-3-21-17(19)20/h7-10,25H,1-6,18H2,(H,22,32)(H,23,30)(H,24,31)(H,26,27)(H,28,29)(H,33,34)(H4,19,20,21) |
| InChIKey | FOPKLEVSDAOHQA-UHFFFAOYSA-N |
| XLogP | -5.15 |
| TPSA | 309.85 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.46 |
| LogP ≤ 5 | -5.15 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|