C18H30N8O10 — CID 18247744
2-[[4-amino-2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-carboxypropanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18247744) has the molecular formula C18H30N8O10 and a molecular weight of 518.48 g/mol. Its IUPAC name is 2-[[4-amino-2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-carboxypropanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[4-amino-2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-carboxypropanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18247744 |
| Molecular Formula | C18H30N8O10 |
| Molecular Weight | 518.48 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | 2-[[4-amino-2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-carboxypropanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(=O)CC(NC(=O)C(CC(=O)O)NC(=O)C(N)CC(=O)O)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C18H30N8O10/c19-7(4-12(28)29)14(32)25-10(6-13(30)31)16(34)26-9(5-11(20)27)15(33)24-8(17(35)36)2-1-3-23-18(21)22/h7-10H,1-6,19H2,(H2,20,27)(H,24,33)(H,25,32)(H,26,34)(H,28,29)(H,30,31)(H,35,36)(H4,21,22,23) |
| InChIKey | YRYQKZJSOOUBKM-UHFFFAOYSA-N |
| XLogP | -5.27 |
| TPSA | 332.71 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.48 |
| LogP ≤ 5 | -5.27 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|