C19H31N7O11 — CID 18247803
4-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-carboxypropanoyl]amino]-5-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-oxopentanoic acid (PubChem CID 18247803) has the molecular formula C19H31N7O11 and a molecular weight of 533.50 g/mol. Its IUPAC name is 4-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-carboxypropanoyl]amino]-5-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-oxopentanoic acid.
| Compound Name | 4-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-carboxypropanoyl]amino]-5-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18247803 |
| Molecular Formula | C19H31N7O11 |
| Molecular Weight | 533.50 g/mol |
| Exact Mass | 533.21 |
| IUPAC Name | 4-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-carboxypropanoyl]amino]-5-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-oxopentanoic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C(CCC(=O)O)NC(=O)C(CC(=O)O)NC(=O)C(N)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C19H31N7O11/c20-8(6-13(29)30)15(33)26-11(7-14(31)32)17(35)24-9(3-4-12(27)28)16(34)25-10(18(36)37)2-1-5-23-19(21)22/h8-11H,1-7,20H2,(H,24,35)(H,25,34)(H,26,33)(H,27,28)(H,29,30)(H,31,32)(H,36,37)(H4,21,22,23) |
| InChIKey | TXBUYHRPMTUGAG-UHFFFAOYSA-N |
| XLogP | -4.28 |
| TPSA | 326.92 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.50 |
| LogP ≤ 5 | -4.28 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|