C15H27N7O7 — CID 145454350
(2S)-5-amino-2-[[(2S)-2-[[(2S)-2-amino-3-carboxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid (PubChem CID 145454350) has the molecular formula C15H27N7O7 and a molecular weight of 417.42 g/mol. Its IUPAC name is (2S)-5-amino-2-[[(2S)-2-[[(2S)-2-amino-3-carboxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[[(2S)-2-[[(2S)-2-amino-3-carboxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 145454350 |
| Molecular Formula | C15H27N7O7 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | (2S)-5-amino-2-[[(2S)-2-[[(2S)-2-amino-3-carboxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CC[C@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H27N7O7/c16-7(6-11(24)25)12(26)21-8(2-1-5-20-15(18)19)13(27)22-9(14(28)29)3-4-10(17)23/h7-9H,1-6,16H2,(H2,17,23)(H,21,26)(H,22,27)(H,24,25)(H,28,29)(H4,18,19,20)/t7-,8-,9-/m0/s1 |
| InChIKey | SOYOSFXLXYZNRG-CIUDSAMLSA-N |
| XLogP | -3.84 |
| TPSA | 266.31 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | -3.84 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|