C20H40N8O5S2 — CID 18242339
2-[[6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 18242339) has the molecular formula C20H40N8O5S2 and a molecular weight of 536.73 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 18242339 |
| Molecular Formula | C20H40N8O5S2 |
| Molecular Weight | 536.73 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | 2-[[6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)C(CCCCN)NC(=O)C(CS)NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C20H40N8O5S2/c1-35-10-7-14(19(32)33)27-17(30)13(6-2-3-8-21)26-18(31)15(11-34)28-16(29)12(22)5-4-9-25-20(23)24/h12-15,34H,2-11,21-22H2,1H3,(H,26,31)(H,27,30)(H,28,29)(H,32,33)(H4,23,24,25) |
| InChIKey | XXRFLHLJZYDSQJ-UHFFFAOYSA-N |
| XLogP | -2.28 |
| TPSA | 241.04 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.73 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|