C21H40N8O7S — CID 18311470
6-amino-2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-carboxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid (PubChem CID 18311470) has the molecular formula C21H40N8O7S and a molecular weight of 548.67 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-carboxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-carboxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18311470 |
| Molecular Formula | C21H40N8O7S |
| Molecular Weight | 548.67 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-carboxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid |
| SMILES | CSCCC(N)C(=O)NC(CC(=O)O)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C21H40N8O7S/c1-37-10-7-12(23)17(32)29-15(11-16(30)31)19(34)27-13(6-4-9-26-21(24)25)18(33)28-14(20(35)36)5-2-3-8-22/h12-15H,2-11,22-23H2,1H3,(H,27,34)(H,28,33)(H,29,32)(H,30,31)(H,35,36)(H4,24,25,26) |
| InChIKey | JNXAUVHYHCFIHN-UHFFFAOYSA-N |
| XLogP | -2.74 |
| TPSA | 278.34 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.67 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|