C20H40N8O6S — CID 18310950
6-amino-2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]hexanoic acid (PubChem CID 18310950) has the molecular formula C20H40N8O6S and a molecular weight of 520.66 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18310950 |
| Molecular Formula | C20H40N8O6S |
| Molecular Weight | 520.66 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]hexanoic acid |
| SMILES | CSCCC(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CO)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C20H40N8O6S/c1-35-10-7-12(22)16(30)26-13(6-4-9-25-20(23)24)17(31)28-15(11-29)18(32)27-14(19(33)34)5-2-3-8-21/h12-15,29H,2-11,21-22H2,1H3,(H,26,30)(H,27,32)(H,28,31)(H,33,34)(H4,23,24,25) |
| InChIKey | UYFNWGRCUANBRP-UHFFFAOYSA-N |
| XLogP | -3.22 |
| TPSA | 261.27 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.66 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|