C20H40N8O5S — CID 18302949
2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]propanoic acid (PubChem CID 18302949) has the molecular formula C20H40N8O5S and a molecular weight of 504.66 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]propanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 18302949 |
| Molecular Formula | C20H40N8O5S |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]propanoic acid |
| SMILES | CSCCC(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CCCCN)C(=O)NC(C)C(=O)O |
| InChI | InChI=1S/C20H40N8O5S/c1-12(19(32)33)26-17(30)15(8-11-34-2)28-18(31)14(7-5-10-25-20(23)24)27-16(29)13(22)6-3-4-9-21/h12-15H,3-11,21-22H2,1-2H3,(H,26,30)(H,27,29)(H,28,31)(H,32,33)(H4,23,24,25) |
| InChIKey | HNYODSXTCGYSOV-UHFFFAOYSA-N |
| XLogP | -2.19 |
| TPSA | 241.04 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|