C18H33N7O7S2 — CID 18310704
3-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-[(1-carboxy-2-sulfanylethyl)amino]-4-oxobutanoic acid (PubChem CID 18310704) has the molecular formula C18H33N7O7S2 and a molecular weight of 523.64 g/mol. Its IUPAC name is 3-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-[(1-carboxy-2-sulfanylethyl)amino]-4-oxobutanoic acid.
| Compound Name | 3-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-[(1-carboxy-2-sulfanylethyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18310704 |
| Molecular Formula | C18H33N7O7S2 |
| Molecular Weight | 523.64 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | 3-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-[(1-carboxy-2-sulfanylethyl)amino]-4-oxobutanoic acid |
| SMILES | CSCCC(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CC(=O)O)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C18H33N7O7S2/c1-34-6-4-9(19)14(28)23-10(3-2-5-22-18(20)21)15(29)24-11(7-13(26)27)16(30)25-12(8-33)17(31)32/h9-12,33H,2-8,19H2,1H3,(H,23,28)(H,24,29)(H,25,30)(H,26,27)(H,31,32)(H4,20,21,22) |
| InChIKey | HCWATPPQQUPWDA-UHFFFAOYSA-N |
| XLogP | -2.94 |
| TPSA | 252.32 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.64 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|