C20H35N7O9S — CID 18241821
4-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-carboxypropanoyl]amino]-5-[(1-carboxy-3-methylsulfanylpropyl)amino]-5-oxopentanoic acid (PubChem CID 18241821) has the molecular formula C20H35N7O9S and a molecular weight of 549.61 g/mol. Its IUPAC name is 4-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-carboxypropanoyl]amino]-5-[(1-carboxy-3-methylsulfanylpropyl)amino]-5-oxopentanoic acid.
| Compound Name | 4-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-carboxypropanoyl]amino]-5-[(1-carboxy-3-methylsulfanylpropyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18241821 |
| Molecular Formula | C20H35N7O9S |
| Molecular Weight | 549.61 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | 4-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-carboxypropanoyl]amino]-5-[(1-carboxy-3-methylsulfanylpropyl)amino]-5-oxopentanoic acid |
| SMILES | CSCCC(NC(=O)C(CCC(=O)O)NC(=O)C(CC(=O)O)NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C20H35N7O9S/c1-37-8-6-12(19(35)36)26-17(33)11(4-5-14(28)29)25-18(34)13(9-15(30)31)27-16(32)10(21)3-2-7-24-20(22)23/h10-13H,2-9,21H2,1H3,(H,25,34)(H,26,33)(H,27,32)(H,28,29)(H,30,31)(H,35,36)(H4,22,23,24) |
| InChIKey | HVAAEQPFTOWVRK-UHFFFAOYSA-N |
| XLogP | -3.00 |
| TPSA | 289.62 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.61 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|