C21H40N8O6S2 — CID 18245412
2-[[5-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]-5-oxopentanoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 18245412) has the molecular formula C21H40N8O6S2 and a molecular weight of 564.74 g/mol. Its IUPAC name is 2-[[5-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]-5-oxopentanoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[5-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]-5-oxopentanoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 18245412 |
| Molecular Formula | C21H40N8O6S2 |
| Molecular Weight | 564.74 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | 2-[[5-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]-5-oxopentanoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)C(CCC(N)=O)NC(=O)C(CCSC)NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C21H40N8O6S2/c1-36-10-7-14(27-17(31)12(22)4-3-9-26-21(24)25)19(33)28-13(5-6-16(23)30)18(32)29-15(20(34)35)8-11-37-2/h12-15H,3-11,22H2,1-2H3,(H2,23,30)(H,27,31)(H,28,33)(H,29,32)(H,34,35)(H4,24,25,26) |
| InChIKey | YEGSFHAAOHBUKI-UHFFFAOYSA-N |
| XLogP | -2.32 |
| TPSA | 258.11 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.74 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|