C21H39N9O7S — CID 18479194
2-[[2-[[5-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]-5-oxopentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 18479194) has the molecular formula C21H39N9O7S and a molecular weight of 561.67 g/mol. Its IUPAC name is 2-[[2-[[5-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]-5-oxopentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[2-[[5-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]-5-oxopentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 18479194 |
| Molecular Formula | C21H39N9O7S |
| Molecular Weight | 561.67 g/mol |
| Exact Mass | 561.27 |
| IUPAC Name | 2-[[2-[[5-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]-5-oxopentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)C(CCCN=C(N)N)NC(=O)C(CCC(N)=O)NC(=O)C(N)CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C21H39N9O7S/c1-38-10-8-14(20(36)37)30-18(34)12(3-2-9-27-21(25)26)29-19(35)13(5-7-16(24)32)28-17(33)11(22)4-6-15(23)31/h11-14H,2-10,22H2,1H3,(H2,23,31)(H2,24,32)(H,28,33)(H,29,35)(H,30,34)(H,36,37)(H4,25,26,27) |
| InChIKey | AWCUSCKBOOWORM-UHFFFAOYSA-N |
| XLogP | -3.81 |
| TPSA | 301.20 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.67 |
| LogP ≤ 5 | -3.81 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|