C16H30N6O6S — CID 18220162
4-amino-5-[[1-[(1-carboxy-3-methylsulfanylpropyl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 18220162) has the molecular formula C16H30N6O6S and a molecular weight of 434.52 g/mol. Its IUPAC name is 4-amino-5-[[1-[(1-carboxy-3-methylsulfanylpropyl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 4-amino-5-[[1-[(1-carboxy-3-methylsulfanylpropyl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18220162 |
| Molecular Formula | C16H30N6O6S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 4-amino-5-[[1-[(1-carboxy-3-methylsulfanylpropyl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CSCCC(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H30N6O6S/c1-29-8-6-11(15(27)28)22-14(26)10(3-2-7-20-16(18)19)21-13(25)9(17)4-5-12(23)24/h9-11H,2-8,17H2,1H3,(H,21,25)(H,22,26)(H,23,24)(H,27,28)(H4,18,19,20) |
| InChIKey | KEBACWCLVOXFNC-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 223.22 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|