C19H35N7O7S2 — CID 18264288
4-amino-5-[[1-[[1-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 18264288) has the molecular formula C19H35N7O7S2 and a molecular weight of 537.67 g/mol. Its IUPAC name is 4-amino-5-[[1-[[1-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 4-amino-5-[[1-[[1-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18264288 |
| Molecular Formula | C19H35N7O7S2 |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 537.20 |
| IUPAC Name | 4-amino-5-[[1-[[1-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CSCCC(NC(=O)C(CS)NC(=O)C(N)CCC(=O)O)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C19H35N7O7S2/c1-35-8-6-11(16(30)25-12(18(32)33)3-2-7-23-19(21)22)24-17(31)13(9-34)26-15(29)10(20)4-5-14(27)28/h10-13,34H,2-9,20H2,1H3,(H,24,31)(H,25,30)(H,26,29)(H,27,28)(H,32,33)(H4,21,22,23) |
| InChIKey | DYEFORVTDOXFRB-UHFFFAOYSA-N |
| XLogP | -2.55 |
| TPSA | 252.32 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|