C17H33N7O5S3 — CID 18310724
2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 18310724) has the molecular formula C17H33N7O5S3 and a molecular weight of 511.70 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18310724 |
| Molecular Formula | C17H33N7O5S3 |
| Molecular Weight | 511.70 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CSCCC(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CS)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C17H33N7O5S3/c1-32-6-4-9(18)13(25)22-10(3-2-5-21-17(19)20)14(26)23-11(7-30)15(27)24-12(8-31)16(28)29/h9-12,30-31H,2-8,18H2,1H3,(H,22,25)(H,23,26)(H,24,27)(H,28,29)(H4,19,20,21) |
| InChIKey | YSYQKRXTNGRGJE-UHFFFAOYSA-N |
| XLogP | -2.48 |
| TPSA | 215.02 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.70 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|