C21H41N11O6S — CID 18245321
2-[[4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18245321) has the molecular formula C21H41N11O6S and a molecular weight of 575.70 g/mol. Its IUPAC name is 2-[[4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18245321 |
| Molecular Formula | C21H41N11O6S |
| Molecular Weight | 575.70 g/mol |
| Exact Mass | 575.30 |
| IUPAC Name | 2-[[4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CSCCC(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CC(N)=O)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C21H41N11O6S/c1-39-9-6-12(30-16(34)11(22)4-2-7-28-20(24)25)17(35)32-14(10-15(23)33)18(36)31-13(19(37)38)5-3-8-29-21(26)27/h11-14H,2-10,22H2,1H3,(H2,23,33)(H,30,34)(H,31,36)(H,32,35)(H,37,38)(H4,24,25,28)(H4,26,27,29) |
| InChIKey | ABARVUKEMCTLPT-UHFFFAOYSA-N |
| XLogP | -4.41 |
| TPSA | 322.51 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.70 |
| LogP ≤ 5 | -4.41 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|