C19H34N8O8 — CID 22700974
2-[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]propanoylamino]pentanedioic acid (PubChem CID 22700974) has the molecular formula C19H34N8O8 and a molecular weight of 502.53 g/mol. Its IUPAC name is 2-[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]propanoylamino]pentanedioic acid.
| Compound Name | 2-[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]propanoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 22700974 |
| Molecular Formula | C19H34N8O8 |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | 2-[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]propanoylamino]pentanedioic acid |
| SMILES | CC(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CCC(N)=O)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C19H34N8O8/c1-9(15(31)27-12(18(34)35)5-7-14(29)30)25-17(33)11(3-2-8-24-19(22)23)26-16(32)10(20)4-6-13(21)28/h9-12H,2-8,20H2,1H3,(H2,21,28)(H,25,33)(H,26,32)(H,27,31)(H,29,30)(H,34,35)(H4,22,23,24) |
| InChIKey | JBPFRGZAABZUPH-UHFFFAOYSA-N |
| XLogP | -3.94 |
| TPSA | 295.41 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | -3.94 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|