C20H39N11O6 — CID 18240547
5-amino-2-[[2-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propanoylamino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid (PubChem CID 18240547) has the molecular formula C20H39N11O6 and a molecular weight of 529.60 g/mol. Its IUPAC name is 5-amino-2-[[2-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propanoylamino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[2-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propanoylamino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18240547 |
| Molecular Formula | C20H39N11O6 |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 529.31 |
| IUPAC Name | 5-amino-2-[[2-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propanoylamino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid |
| SMILES | CC(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C20H39N11O6/c1-10(29-16(34)11(21)4-2-8-27-19(23)24)15(33)30-12(5-3-9-28-20(25)26)17(35)31-13(18(36)37)6-7-14(22)32/h10-13H,2-9,21H2,1H3,(H2,22,32)(H,29,34)(H,30,33)(H,31,35)(H,36,37)(H4,23,24,27)(H4,25,26,28) |
| InChIKey | DXAKRVZIUUPUTF-UHFFFAOYSA-N |
| XLogP | -4.75 |
| TPSA | 322.51 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | -4.75 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|