C12H24N6O5S — CID 18218685
2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 18218685) has the molecular formula C12H24N6O5S and a molecular weight of 364.43 g/mol. Its IUPAC name is 2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 18218685 |
| Molecular Formula | C12H24N6O5S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)NC(CS)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C12H24N6O5S/c13-6(2-1-3-16-12(14)15)9(20)18-8(5-24)10(21)17-7(4-19)11(22)23/h6-8,19,24H,1-5,13H2,(H,17,21)(H,18,20)(H,22,23)(H4,14,15,16) |
| InChIKey | JVMKBJNSRZWDBO-UHFFFAOYSA-N |
| XLogP | -3.66 |
| TPSA | 206.15 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | -3.66 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|