C21H42N8O5 — CID 22703064
2-[[6-amino-2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]propanoic acid (PubChem CID 22703064) has the molecular formula C21H42N8O5 and a molecular weight of 486.62 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]propanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 22703064 |
| Molecular Formula | C21H42N8O5 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.33 |
| IUPAC Name | 2-[[6-amino-2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]propanoic acid |
| SMILES | CC(C)CC(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCCCN)C(=O)NC(C)C(=O)O |
| InChI | InChI=1S/C21H42N8O5/c1-12(2)11-14(23)17(30)28-16(8-6-10-26-21(24)25)19(32)29-15(7-4-5-9-22)18(31)27-13(3)20(33)34/h12-16H,4-11,22-23H2,1-3H3,(H,27,31)(H,28,30)(H,29,32)(H,33,34)(H4,24,25,26) |
| InChIKey | RVAPCJYQVDSURW-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 241.04 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|