C15H29N5O5S2 — CID 18258954
2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-3-sulfanylpropanoyl]amino]propanoic acid (PubChem CID 18258954) has the molecular formula C15H29N5O5S2 and a molecular weight of 423.56 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-3-sulfanylpropanoyl]amino]propanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-3-sulfanylpropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 18258954 |
| Molecular Formula | C15H29N5O5S2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-3-sulfanylpropanoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)C(CS)NC(=O)C(CCCCN)NC(=O)C(N)CS)C(=O)O |
| InChI | InChI=1S/C15H29N5O5S2/c1-8(15(24)25)18-14(23)11(7-27)20-13(22)10(4-2-3-5-16)19-12(21)9(17)6-26/h8-11,26-27H,2-7,16-17H2,1H3,(H,18,23)(H,19,21)(H,20,22)(H,24,25) |
| InChIKey | FAHRVLRTXSIGGA-UHFFFAOYSA-N |
| XLogP | -2.14 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|