C16H31N5O6S — CID 18749570
2-[[2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]-3-sulfanylpropanoyl]amino]propanoic acid (PubChem CID 18749570) has the molecular formula C16H31N5O6S and a molecular weight of 421.52 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]-3-sulfanylpropanoyl]amino]propanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]-3-sulfanylpropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 18749570 |
| Molecular Formula | C16H31N5O6S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]-3-sulfanylpropanoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)C(CS)NC(=O)C(CCCCN)NC(=O)C(N)C(C)O)C(=O)O |
| InChI | InChI=1S/C16H31N5O6S/c1-8(16(26)27)19-14(24)11(7-28)21-13(23)10(5-3-4-6-17)20-15(25)12(18)9(2)22/h8-12,22,28H,3-7,17-18H2,1-2H3,(H,19,24)(H,20,25)(H,21,23)(H,26,27) |
| InChIKey | XZPJKLHAVFLWQJ-UHFFFAOYSA-N |
| XLogP | -2.69 |
| TPSA | 196.87 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|