C17H32N6O7 — CID 18749492
4-amino-2-[2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]propanoylamino]-4-oxobutanoic acid (PubChem CID 18749492) has the molecular formula C17H32N6O7 and a molecular weight of 432.48 g/mol. Its IUPAC name is 4-amino-2-[2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]propanoylamino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]propanoylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18749492 |
| Molecular Formula | C17H32N6O7 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 4-amino-2-[2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]propanoylamino]-4-oxobutanoic acid |
| SMILES | CC(NC(=O)C(CCCCN)NC(=O)C(N)C(C)O)C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C17H32N6O7/c1-8(14(26)23-11(17(29)30)7-12(19)25)21-15(27)10(5-3-4-6-18)22-16(28)13(20)9(2)24/h8-11,13,24H,3-7,18,20H2,1-2H3,(H2,19,25)(H,21,27)(H,22,28)(H,23,26)(H,29,30) |
| InChIKey | JYZWYVCMJXUHLE-UHFFFAOYSA-N |
| XLogP | -3.74 |
| TPSA | 239.96 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | -3.74 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|