C19H38N6O6S — CID 18749712
2-[[6-amino-2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]hexanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 18749712) has the molecular formula C19H38N6O6S and a molecular weight of 478.62 g/mol. Its IUPAC name is 2-[[6-amino-2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]hexanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[6-amino-2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]hexanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18749712 |
| Molecular Formula | C19H38N6O6S |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | 2-[[6-amino-2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]hexanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CC(O)C(N)C(=O)NC(CCCCN)C(=O)NC(CCCCN)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C19H38N6O6S/c1-11(26)15(22)18(29)24-13(7-3-5-9-21)16(27)23-12(6-2-4-8-20)17(28)25-14(10-32)19(30)31/h11-15,26,32H,2-10,20-22H2,1H3,(H,23,27)(H,24,29)(H,25,28)(H,30,31) |
| InChIKey | YAIWELSSGYOWBO-UHFFFAOYSA-N |
| XLogP | -2.58 |
| TPSA | 222.89 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|