C7H14N2O4S — CID 18218245
2-[(2-amino-3-hydroxybutanoyl)amino]-3-sulfanylpropanoic acid (PubChem CID 18218245) has the molecular formula C7H14N2O4S and a molecular weight of 222.27 g/mol. Its IUPAC name is 2-[(2-amino-3-hydroxybutanoyl)amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[(2-amino-3-hydroxybutanoyl)amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18218245 |
| Molecular Formula | C7H14N2O4S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 2-[(2-amino-3-hydroxybutanoyl)amino]-3-sulfanylpropanoic acid |
| SMILES | CC(O)C(N)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C7H14N2O4S/c1-3(10)5(8)6(11)9-4(2-14)7(12)13/h3-5,10,14H,2,8H2,1H3,(H,9,11)(H,12,13) |
| InChIKey | CUTPSEKWUPZFLV-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|