C10H19N3O5S — CID 18224176
2-[2-[(2-amino-3-hydroxybutanoyl)amino]propanoylamino]-3-sulfanylpropanoic acid (PubChem CID 18224176) has the molecular formula C10H19N3O5S and a molecular weight of 293.35 g/mol. Its IUPAC name is 2-[2-[(2-amino-3-hydroxybutanoyl)amino]propanoylamino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[2-[(2-amino-3-hydroxybutanoyl)amino]propanoylamino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18224176 |
| Molecular Formula | C10H19N3O5S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 2-[2-[(2-amino-3-hydroxybutanoyl)amino]propanoylamino]-3-sulfanylpropanoic acid |
| SMILES | CC(NC(=O)C(N)C(C)O)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C10H19N3O5S/c1-4(12-9(16)7(11)5(2)14)8(15)13-6(3-19)10(17)18/h4-7,14,19H,3,11H2,1-2H3,(H,12,16)(H,13,15)(H,17,18) |
| InChIKey | YRNBANYVJJBGDI-UHFFFAOYSA-N |
| XLogP | -2.30 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|