C14H24N4O8S — CID 18745180
2-[[2-[2-[(2-amino-3-hydroxybutanoyl)amino]propanoylamino]-3-sulfanylpropanoyl]amino]butanedioic acid (PubChem CID 18745180) has the molecular formula C14H24N4O8S and a molecular weight of 408.43 g/mol. Its IUPAC name is 2-[[2-[2-[(2-amino-3-hydroxybutanoyl)amino]propanoylamino]-3-sulfanylpropanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[2-[(2-amino-3-hydroxybutanoyl)amino]propanoylamino]-3-sulfanylpropanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18745180 |
| Molecular Formula | C14H24N4O8S |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 2-[[2-[2-[(2-amino-3-hydroxybutanoyl)amino]propanoylamino]-3-sulfanylpropanoyl]amino]butanedioic acid |
| SMILES | CC(NC(=O)C(N)C(C)O)C(=O)NC(CS)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C14H24N4O8S/c1-5(16-13(24)10(15)6(2)19)11(22)18-8(4-27)12(23)17-7(14(25)26)3-9(20)21/h5-8,10,19,27H,3-4,15H2,1-2H3,(H,16,24)(H,17,23)(H,18,22)(H,20,21)(H,25,26) |
| InChIKey | IFNQRNZFPDQHJT-UHFFFAOYSA-N |
| XLogP | -3.34 |
| TPSA | 208.15 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | -3.34 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|