C20H28N4O8S — CID 18746956
2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-sulfanylpropanoyl]amino]-3-phenylpropanoyl]amino]butanedioic acid (PubChem CID 18746956) has the molecular formula C20H28N4O8S and a molecular weight of 484.53 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-sulfanylpropanoyl]amino]-3-phenylpropanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-sulfanylpropanoyl]amino]-3-phenylpropanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18746956 |
| Molecular Formula | C20H28N4O8S |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-sulfanylpropanoyl]amino]-3-phenylpropanoyl]amino]butanedioic acid |
| SMILES | CC(O)C(N)C(=O)NC(CS)C(=O)NC(Cc1ccccc1)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H28N4O8S/c1-10(25)16(21)19(30)24-14(9-33)18(29)22-12(7-11-5-3-2-4-6-11)17(28)23-13(20(31)32)8-15(26)27/h2-6,10,12-14,16,25,33H,7-9,21H2,1H3,(H,22,29)(H,23,28)(H,24,30)(H,26,27)(H,31,32) |
| InChIKey | YVOQKSOAMAMBOF-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 208.15 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|