C17H23N3O7 — CID 18224426
2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-phenylpropanoyl]amino]butanedioic acid (PubChem CID 18224426) has the molecular formula C17H23N3O7 and a molecular weight of 381.39 g/mol. Its IUPAC name is 2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-phenylpropanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-phenylpropanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18224426 |
| Molecular Formula | C17H23N3O7 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-phenylpropanoyl]amino]butanedioic acid |
| SMILES | CC(O)C(N)C(=O)NC(Cc1ccccc1)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H23N3O7/c1-9(21)14(18)16(25)19-11(7-10-5-3-2-4-6-10)15(24)20-12(17(26)27)8-13(22)23/h2-6,9,11-12,14,21H,7-8,18H2,1H3,(H,19,25)(H,20,24)(H,22,23)(H,26,27) |
| InChIKey | WYLAVUAWOUVUCA-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 179.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |