C21H30N4O8S — CID 18750372
2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoyl]amino]pentanedioic acid (PubChem CID 18750372) has the molecular formula C21H30N4O8S and a molecular weight of 498.56 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18750372 |
| Molecular Formula | C21H30N4O8S |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoyl]amino]pentanedioic acid |
| SMILES | CC(O)C(N)C(=O)NC(Cc1ccccc1)C(=O)NC(CS)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C21H30N4O8S/c1-11(26)17(22)20(31)24-14(9-12-5-3-2-4-6-12)18(29)25-15(10-34)19(30)23-13(21(32)33)7-8-16(27)28/h2-6,11,13-15,17,26,34H,7-10,22H2,1H3,(H,23,30)(H,24,31)(H,25,29)(H,27,28)(H,32,33) |
| InChIKey | VALNCZXGJNTUNB-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 208.15 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|