C22H30N4O9S — CID 22697866
2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoyl]amino]pentanedioic acid (PubChem CID 22697866) has the molecular formula C22H30N4O9S and a molecular weight of 526.57 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 22697866 |
| Molecular Formula | C22H30N4O9S |
| Molecular Weight | 526.57 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoyl]amino]pentanedioic acid |
| SMILES | NC(CCC(=O)O)C(=O)NC(Cc1ccccc1)C(=O)NC(CS)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H30N4O9S/c23-13(6-8-17(27)28)19(31)25-15(10-12-4-2-1-3-5-12)20(32)26-16(11-36)21(33)24-14(22(34)35)7-9-18(29)30/h1-5,13-16,36H,6-11,23H2,(H,24,33)(H,25,31)(H,26,32)(H,27,28)(H,29,30)(H,34,35) |
| InChIKey | WGSFFHCWTGNKTP-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 225.22 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.57 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|