C22H28N4O11 — CID 175735271
(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-4-carboxybutanoyl]amino]-3-carboxypropanoyl]amino]-3-phenylpropanoyl]amino]butanedioic acid (PubChem CID 175735271) has the molecular formula C22H28N4O11 and a molecular weight of 524.48 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-4-carboxybutanoyl]amino]-3-carboxypropanoyl]amino]-3-phenylpropanoyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-4-carboxybutanoyl]amino]-3-carboxypropanoyl]amino]-3-phenylpropanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 175735271 |
| Molecular Formula | C22H28N4O11 |
| Molecular Weight | 524.48 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-4-carboxybutanoyl]amino]-3-carboxypropanoyl]amino]-3-phenylpropanoyl]amino]butanedioic acid |
| SMILES | N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H28N4O11/c23-12(6-7-16(27)28)19(33)24-14(9-17(29)30)21(35)25-13(8-11-4-2-1-3-5-11)20(34)26-15(22(36)37)10-18(31)32/h1-5,12-15H,6-10,23H2,(H,24,33)(H,25,35)(H,26,34)(H,27,28)(H,29,30)(H,31,32)(H,36,37)/t12-,13-,14-,15-/m0/s1 |
| InChIKey | QXSSXCATDBOXFN-AJNGGQMLSA-N |
| XLogP | -2.09 |
| TPSA | 262.52 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.48 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |