C26H35N5O12 — CID 175962053
(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-4-carboxybutanoyl]amino]propanoyl]amino]-4-carboxybutanoyl]amino]-3-phenylpropanoyl]amino]butanedioic acid (PubChem CID 175962053) has the molecular formula C26H35N5O12 and a molecular weight of 609.59 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-4-carboxybutanoyl]amino]propanoyl]amino]-4-carboxybutanoyl]amino]-3-phenylpropanoyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-4-carboxybutanoyl]amino]propanoyl]amino]-4-carboxybutanoyl]amino]-3-phenylpropanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 175962053 |
| Molecular Formula | C26H35N5O12 |
| Molecular Weight | 609.59 g/mol |
| Exact Mass | 609.23 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-4-carboxybutanoyl]amino]propanoyl]amino]-4-carboxybutanoyl]amino]-3-phenylpropanoyl]amino]butanedioic acid |
| SMILES | C[C@H](NC(=O)[C@@H](N)CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C26H35N5O12/c1-13(28-23(39)15(27)7-9-19(32)33)22(38)29-16(8-10-20(34)35)24(40)30-17(11-14-5-3-2-4-6-14)25(41)31-18(26(42)43)12-21(36)37/h2-6,13,15-18H,7-12,27H2,1H3,(H,28,39)(H,29,38)(H,30,40)(H,31,41)(H,32,33)(H,34,35)(H,36,37)(H,42,43)/t13-,15-,16-,17-,18-/m0/s1 |
| InChIKey | PTQKWDONGWNUCW-HILJTLORSA-N |
| XLogP | -2.20 |
| TPSA | 291.62 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.59 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |