C23H32N4O11 — CID 18747457
2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-carboxybutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]pentanedioic acid (PubChem CID 18747457) has the molecular formula C23H32N4O11 and a molecular weight of 540.53 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-carboxybutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-carboxybutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18747457 |
| Molecular Formula | C23H32N4O11 |
| Molecular Weight | 540.53 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-carboxybutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]pentanedioic acid |
| SMILES | CC(O)C(N)C(=O)NC(CCC(=O)O)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C23H32N4O11/c1-11(28)19(24)22(36)25-14(6-8-17(30)31)20(34)27-16(10-12-2-4-13(29)5-3-12)21(35)26-15(23(37)38)7-9-18(32)33/h2-5,11,14-16,19,28-29H,6-10,24H2,1H3,(H,25,36)(H,26,35)(H,27,34)(H,30,31)(H,32,33)(H,37,38) |
| InChIKey | DZGVPILOOPTKRO-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 265.68 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.53 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |