C24H37N7O9 — CID 18745860
2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]pentanedioic acid (PubChem CID 18745860) has the molecular formula C24H37N7O9 and a molecular weight of 567.60 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18745860 |
| Molecular Formula | C24H37N7O9 |
| Molecular Weight | 567.60 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]pentanedioic acid |
| SMILES | CC(O)C(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C24H37N7O9/c1-12(32)19(25)22(38)29-15(3-2-10-28-24(26)27)20(36)31-17(11-13-4-6-14(33)7-5-13)21(37)30-16(23(39)40)8-9-18(34)35/h4-7,12,15-17,19,32-33H,2-3,8-11,25H2,1H3,(H,29,38)(H,30,37)(H,31,36)(H,34,35)(H,39,40)(H4,26,27,28) |
| InChIKey | ZNXARTPKKAWDIT-UHFFFAOYSA-N |
| XLogP | -2.90 |
| TPSA | 292.78 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.60 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|