C29H39N7O9 — CID 19950771
2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]pentanedioic acid (PubChem CID 19950771) has the molecular formula C29H39N7O9 and a molecular weight of 629.67 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 19950771 |
| Molecular Formula | C29H39N7O9 |
| Molecular Weight | 629.67 g/mol |
| Exact Mass | 629.28 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]pentanedioic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C(N)Cc1ccc(O)cc1)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C29H39N7O9/c30-20(14-16-3-7-18(37)8-4-16)25(41)34-21(2-1-13-33-29(31)32)26(42)36-23(15-17-5-9-19(38)10-6-17)27(43)35-22(28(44)45)11-12-24(39)40/h3-10,20-23,37-38H,1-2,11-15,30H2,(H,34,41)(H,35,43)(H,36,42)(H,39,40)(H,44,45)(H4,31,32,33) |
| InChIKey | YMHWYILUPVCHDU-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 292.78 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.67 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|