C26H43N11O7 — CID 22651311
5-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid (PubChem CID 22651311) has the molecular formula C26H43N11O7 and a molecular weight of 621.70 g/mol. Its IUPAC name is 5-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 22651311 |
| Molecular Formula | C26H43N11O7 |
| Molecular Weight | 621.70 g/mol |
| Exact Mass | 621.33 |
| IUPAC Name | 5-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CCC(NC(=O)C(CCCN=C(N)N)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C26H43N11O7/c27-16(3-1-11-33-25(29)30)21(40)37-19(13-14-5-7-15(38)8-6-14)23(42)35-17(4-2-12-34-26(31)32)22(41)36-18(24(43)44)9-10-20(28)39/h5-8,16-19,38H,1-4,9-13,27H2,(H2,28,39)(H,35,42)(H,36,41)(H,37,40)(H,43,44)(H4,29,30,33)(H4,31,32,34) |
| InChIKey | BJAVBOVQGZIEFA-UHFFFAOYSA-N |
| XLogP | -3.83 |
| TPSA | 342.74 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.70 |
| LogP ≤ 5 | -3.83 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|